Index of /fileRepository/docs/chemicaltreatment/documents
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 117 - 2008 JSWC - Se..> | 2009-06-11 09:17 | 654K | |
| 393-Filter Strip wit..> | 2009-06-11 09:17 | 125K | |
| 969-P Reduction from..> | 2009-06-11 09:17 | 263K | |
| 1168-P reduction in ..> | 2009-06-11 09:17 | 116K | |
| 1689- Soil Berms wit..> | 2009-06-11 09:17 | 99K | |
| 1786-Green, Stott PA..> | 2009-06-11 09:17 | 138K | |
| ALUM TREATMENT OF ST..> | 2009-06-11 09:17 | 329K | |
| ALUM TREATMENT OF SW..> | 2009-06-11 09:17 | 807K | |
| Agyin-Birikorang, 20..> | 2009-06-11 09:17 | 788K | |
| Agyin-Birikorang and..> | 2009-06-11 09:17 | 139K | |
| Agyin-Birikorang and..> | 2009-06-11 09:17 | 660K | |
| Agyin-Birikorang et ..> | 2009-06-11 09:17 | 948K | |
| Agyin-Birikorang et ..> | 2009-06-11 09:17 | 378K | |
![[ ]](/icons/unknown.gif) | Agyin-Birikorang et ..> | 2009-06-11 09:17 | 829K | |
| Anderson et al., 199..> | 2009-06-11 09:17 | 1.0M | |
| Ann, Reddy, and Delf..> | 2009-06-11 09:17 | 211K | |
| Barker and Zublena, ..> | 2009-06-11 09:17 | 33K | |
| Basta et al., 2000.pdf | 2009-06-11 09:17 | 192K | |
| Bayley et al., 2008.pdf | 2009-06-11 09:17 | 1.1M | |
| Benner, 1997.pdf | 2009-06-11 09:17 | 1.4M | |
| Blowes et al., 2000.pdf | 2009-06-11 09:17 | 497K | |
| BruneauRiverImplemen..> | 2009-06-11 09:17 | 2.8M | |
| Bugbee and Frink, 19..> | 2009-06-11 09:17 | 24M | |
| Burns et al., 2001.pdf | 2009-06-11 09:17 | 173K | |
| Butkus et al., 1998.pdf | 2009-06-11 09:17 | 239K | |
| CAT-PAM for P Remova..> | 2009-06-11 09:17 | 48K | |
| CH4C.pdf | 2009-06-11 09:17 | 2.3M | |
| CHAPTER VIII COMPREH..> | 2009-06-11 09:15 | 37K | |
| CHEMICAL COAGULATION..> | 2009-06-11 09:15 | 620K | |
| CHEMTREATMENT.pdf | 2009-06-11 09:15 | 59K | |
| CRAMICRO.pdf | 2009-06-11 09:15 | 3.1M | |
| CT-SS_Analytical_dat..> | 2009-06-11 09:15 | 552K | |
| CT-SS_Field_Data.xls | 2009-06-11 09:15 | 625K | |
| CTINTRO.pdf | 2009-06-11 09:15 | 662K | |
| CURRENT RESEARCH A..> | 2009-06-11 09:15 | 257K | |
| Codling et al., 2000..> | 2009-06-11 09:15 | 193K | |
| Cox, Camberato, and ..> | 2009-06-11 09:15 | 171K | |
| DairyBATLitReview.pdf | 2009-06-11 09:15 | 183K | |
| Dayton and Basta, 20..> | 2009-06-11 09:15 | 727K | |
| Dayton and Basta, 20..> | 2009-06-11 09:15 | 797K | |
| Dayton and Basta, 20..> | 2009-06-11 09:15 | 677K | |
| Dayton et al, 2003.pdf | 2009-06-11 09:15 | 2.0M | |
| DeBusk_HWTT1_FINAL.pdf | 2009-06-11 09:15 | 347K | |
| DeBusk et al 2005b.pdf | 2009-06-11 09:15 | 210K | |
| Debusk et al 2005a.pdf | 2009-06-11 09:15 | 4.6M | |
| Dong, Ramsey, and Th..> | 2009-06-11 09:15 | 674K | |
| Driscoll and Driscol..> | 2009-06-11 09:15 | 78K | |
| EPA2008.pdf | 2009-06-11 09:16 | 774K | |
| ESPREP.pdf | 2009-06-11 09:16 | 849K | |
| Elliott, Dempsey, an..> | 2009-06-11 09:16 | 12M | |
| Elliott and Dempsey,..> | 2009-06-11 09:16 | 41M | |
| Elliott and Singer, ..> | 2009-06-11 09:16 | 14M | |
| Elliott and Taylor, ..> | 2009-06-11 09:16 | 138K | |
| Elliott et al., 1990..> | 2009-06-11 09:16 | 144K | |
| Elliott et al., 2002..> | 2009-06-11 09:16 | 97K | |
| Elliott et al., 2002..> | 2009-06-11 09:16 | 905K | |
| FDEP2005.pdf | 2009-06-11 09:16 | 1.4M | |
| FLDEP, 2006.pdf | 2009-06-11 09:16 | 633K | |
| Felix et al., 2008.pdf | 2009-06-11 09:16 | 286K | |
| Fest et al. 2007.pdf | 2009-06-11 09:16 | 640K | |
| Gallimore et al., 19..> | 2009-06-11 09:16 | 157K | |
| Green, Stott 1999 Ef..> | 2009-06-11 09:16 | 392K | |
| Guerin et al., 2002.pdf | 2009-06-11 09:16 | 433K | |
| Hansen et al., 2002.pdf | 2009-06-11 09:17 | 52K | |
| Heil and Barbarick, ..> | 2009-06-11 09:16 | 245K | |
| Hiscock, Thourot, an..> | 2009-06-11 09:16 | 236K | |
| Hoge et al., 2003.pdf | 2009-06-11 09:16 | 35M | |
| Hooda et al., 2000.pdf | 2009-06-11 09:16 | 165K | |
| Hyde and Morris, 200..> | 2009-06-11 09:16 | 237K | |
| Hyde and Morris, 200..> | 2009-06-11 09:16 | 183K | |
| Ippolito, Barbarick,..> | 2009-06-11 09:16 | 199K | |
| Ippolito and barbari..> | 2009-06-11 09:16 | 98K | |
| Ippolito et al., 200..> | 2009-06-11 09:16 | 84K | |
| Ippolito et al., 200..> | 2009-06-11 09:16 | 1.1M | |
| Jain et al., 2005.pdf | 2009-06-11 09:16 | 47M | |
| Kellogg et al., 2000..> | 2009-06-11 09:16 | 23M | |
| LONG-TERM PERFORMANC..> | 2009-06-11 09:16 | 8.1M | |
| LOPP, 2008.pdf | 2009-06-11 09:17 | 98K | |
| Lai et al., 2005.pdf | 2009-06-11 09:16 | 335K | |
| Livesay and Huang, 1..> | 2009-06-11 09:16 | 24M | |
| MICROPEER.pdf | 2009-06-11 09:16 | 472K | |
| Madison et al., 2009..> | 2009-06-11 09:16 | 387K | |
| Makris, 2004.pdf | 2009-06-11 09:16 | 2.0M | |
| Makris et al., 2004a..> | 2009-06-11 09:16 | 376K | |
| Makris et al., 2004b..> | 2009-06-11 09:16 | 214K | |
| Makris et al., 2005a..> | 2009-06-11 09:16 | 210K | |
| Makris et al., 2005a..> | 2009-06-11 09:16 | 376K | |
| Makris et al., 2005b..> | 2009-06-11 09:16 | 297K | |
| Makris et al., 2005c..> | 2009-06-11 09:16 | 210K | |
| Makris et al., 2006.pdf | 2009-06-11 09:16 | 175K | |
| Maurer and Boller, 1..> | 2009-06-11 09:16 | 1.0M | |
| Meng et al., 2001.pdf | 2009-06-11 09:16 | 122K | |
| Moore et al., 1994.pdf | 2009-06-11 09:16 | 225K | |
| Moore et al., 1999.pdf | 2009-06-11 09:16 | 116K | |
| Moore et al., 2000.pdf | 2009-06-11 09:16 | 325K | |
| NCSU PAM Tests for t..> | 2009-06-11 09:16 | 1.7M | |
| Nair and Harris, 200..> | 2009-06-11 09:16 | 319K | |
| Nair et al., 2004.pdf | 2009-06-11 09:16 | 93K | |
| Novak and Watts, 200..> | 2009-06-11 09:16 | 740K | |
| Novak and Watts, 200..> | 2009-06-11 09:16 | 562K | |
| Novak and Watts 2005..> | 2009-06-11 09:16 | 215K | |
| Novak et al., 2000.pdf | 2009-06-11 09:16 | 174K | |
| Oladeji, 2006.pdf | 2009-06-11 09:16 | 1.6M | |
| Oladeji et al., 2007..> | 2009-06-11 09:16 | 279K | |
| Omoike and Vanloon, ..> | 2009-06-11 09:16 | 190K | |
| PAM + Alum and PAM +..> | 2009-06-11 09:16 | 710K | |
| PAM + Compost filter..> | 2009-06-11 09:16 | 287K | |
| PAM Efficienty for P..> | 2009-06-11 09:16 | 741K | |
| PAM and Wood Fiber f..> | 2009-06-11 09:16 | 133K | |
| PHOSPHORUS INACTIVAT..> | 2009-06-11 09:16 | 568K | |
| P Removal Document.pdf | 2009-06-11 09:16 | 169K | |
| Paulter and Sims, 20..> | 2009-06-11 09:16 | 282K | |
| Peters and Basta, 19..> | 2009-06-11 09:16 | 201K | |
| Prakash and Sengupta..> | 2009-06-11 09:16 | 300K | |
| Puls, Blowes, and Gi..> | 2009-06-11 09:16 | 3.3M | |
| REDUCING P RUNOFF-IM..> | 2009-06-11 09:16 | 695K | |
| Reedy_Creek_Phosphor..> | 2009-06-11 09:16 | 50K | |
| Relevant References.pdf | 2009-06-11 09:16 | 52K | |
| Rengasamy, Oades, an..> | 2009-06-11 09:16 | 16M | |
| Rhoton and Bigham, 2..> | 2009-06-11 09:16 | 124K | |
| Rosa, Henry, and Amm..> | 2009-06-11 09:16 | 761K | |
| SFWMD-ECP_intro_2000..> | 2009-06-11 09:17 | 857K | |
![[IMG]](/icons/image2.gif) | SFWMDLOGOSEAL_BLUE_3..> | 2009-06-11 09:17 | 23K | |
| SLUDGE_TEST_PROPOSED..> | 2009-06-11 09:17 | 14K | |
| SWET2001a.pdf | 2009-06-11 09:17 | 230K | |
| SWET2001b.pdf | 2009-06-11 09:17 | 179K | |
| SWET2002a.pdf | 2009-06-11 09:17 | 447K | |
| SWET2002b.pdf | 2009-06-11 09:17 | 10M | |
| SWET2008a.pdf | 2009-06-11 09:17 | 3.3M | |
| SWET2008b.pdf | 2009-06-11 09:17 | 1.3M | |
| Salton Sea Final Rep..> | 2009-06-11 09:17 | 2.7M | |
| Sarkar et al., 2006.pdf | 2009-06-11 09:17 | 290K | |
| Sarkar et al., 2007.pdf | 2009-06-11 09:17 | 290K | |
| Screening_Eval_Polym..> | 2009-06-11 09:17 | 780K | |
| Sed & P Reduction fr..> | 2009-06-11 09:17 | 169K | |
| Sed. & P Control wit..> | 2009-06-11 09:17 | 177K | |
| Self-Davis et al., 1..> | 2009-06-11 09:17 | 12M | |
| Silveira et al., 200..> | 2009-06-11 09:17 | 1.4M | |
| Sims, Simard, and Jo..> | 2009-06-11 09:17 | 508K | |
| Sloan, Basta, and We..> | 2009-06-11 09:17 | 815K | |
| TAMU-P reduction fro..> | 2009-06-11 09:17 | 48K | |
| TP226 Overview of th..> | 2009-06-11 09:17 | 179K | |
| Townsend et al., 200..> | 2009-06-11 09:17 | 283K | |
| Treatment_Objectives..> | 2009-06-11 09:17 | 133K | |
| ULTRAINT.pdf | 2009-06-11 09:17 | 88K | |
| ULTRAREP.pdf | 2009-06-11 09:17 | 95K | |
| USDA ARS, 2009.pdf | 2009-06-11 09:17 | 123K | |
| USDA PAM use fro Nut..> | 2009-06-11 09:17 | 169K | |
| USEPA, 1996.pdf | 2009-06-11 09:17 | 5.0M | |
| Valdivia et al., 197..> | 2009-06-11 09:17 | 485K | |
| Valdivia et al., 198..> | 2009-06-11 09:17 | 676K | |
| Van Alstyle et al., ..> | 2009-06-11 09:17 | 215K | |
| Viraraghavan and Ion..> | 2009-06-11 09:17 | 89K | |
| WATER TREATMENT RESI..> | 2009-06-11 09:17 | 205K | |
| Watershed Technologi..> | 2009-06-11 09:17 | 4.1M | |
| Zhang, Ray, and Stei..> | 2009-06-11 09:17 | 209K | |
| haustein et al., 200..> | 2009-06-11 09:16 | 178K | |
| rdct_of_losses_app_p..> | 2009-06-11 09:16 | 408K | |
|
|---|
